Urolithin powder supplier

  What is Urolithin B ? Urolithin B powder? Urolithin B  powder ( CAS NO :1139-83-9) is an urolithin, a type of phenolic compounds produced in the human gut after absorption of ellagitannins-containing food such as pomegranate,strawberries, red raspberries, walnuts or oak-aged red wine. Urolithin B is found in the urine in the form of urolithin B glucuronide. Urolithin B decreases protein degradation and induces muscle hypertrophy. Urolithin B inhibits the activity of aromatase, an enzyme that interconverts estrogen and testosterone. Urolithin B is a natural product with antiproliferative and antioxidant activity. Urolithin B has been shown to cross the blood brain barrier, and may have neuroprotective effects against Alzheimer’s Disease. Urolithin B is an intestinal microbial metabolite of ellagitannis and exhibits potent anti-oxidant and pro-oxidant activies depending on the assay system and conditions. Urolithin B can also display estrogenic and/or anti-estrogenic activity....

  Chemical information of Urolithin B Product Name href="https://www.phcoker.com/our-products/urolithin/" Urolithin B powder Chemical Name 3-hydroxy-6H-benzo[c]chromen-6-one 3-hydroxybenzo[c]chromen-6-one Uro-B 3-Hydroxyurolithin CAS Number 1139-83-9 InChIKey WXUQMTRHPNOXBV-UHFFFAOYSA-N SMILE C1=CC=C2C(=C1)C3=C(C=C(C=C3)O)OC2=O Molecular Formula C 13 H 8 O 3 Molecular Weight 212.2 g/mol Monoisotopic Mass 212.047344 g/mol Melting Point 247 °C Color white to beige  powder Solubility DMSO: soluble5mg/mL, clear (warmed) S torage temp 2-8°C Application Urolithin B  has been used in bodybuilding and supplements area.   What is Urolithin B  ? Urolithin B powder ? Urolithin B powder ( CAS NO :1139-83-9) is an urolithin, a type of phenolic compounds produced in the human gut after absorption of ellagitannins-containing food such as pomegranate,strawberries, red raspberries, walnuts or oak-aged red wine. Urolithin B is found in the urine in the form of urolithin B g...